About (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine
(2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 158105761) has the molecular formula C15H25F3N6
and a molecular weight of 346.40 g/mol. Its IUPAC name is (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine |
| PubChem CID | 158105761 |
| Molecular Formula | C15H25F3N6 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | C[C@H]1CN(c2nccc(C(F)(F)F)n2)CCN1.C[C@H]1CNCCN1 |
| InChI | InChI=1S/C10H13F3N4.C5H12N2/c1-7-6-17(5-4-14-7)9-15-3-2-8(16-9)10(11,12)13;1-5-4-6-2-3-7-5/h2-3,7,14H,4-6H2,1H3;5-7H,2-4H2,1H3/t7-;5-/m00/s1 |
| InChIKey | FPUPESLKITUODZ-SJEAMFKXSA-N |
| XLogP | 0.86 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
The IUPAC name of (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine (CID 158105761) is (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
The canonical SMILES for (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine is C[C@H]1CN(c2nccc(C(F)(F)F)n2)CCN1.C[C@H]1CNCCN1.
What is the InChIKey of (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
The InChIKey is FPUPESLKITUODZ-SJEAMFKXSA-N. The full InChI is InChI=1S/C10H13F3N4.C5H12N2/c1-7-6-17(5-4-14-7)9-15-3-2-8(16-9)10(11,12)13;1-5-4-6-2-3-7-5/h2-3,7,14H,4-6H2,1H3;5-7H,2-4H2,1H3/t7-;5-/m00/s1.
What are the key properties of (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
(2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine has a molecular weight of 346.40 g/mol, XLogP of 0.86, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methylpiperazine;2-[(3S)-3-methylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 158105761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).