C31H45BN8O4S2 — CID 158110725
bis(5-(4-methoxy-5-methyl-2-propan-2-ylphenyl)sulfanylpyrimidine-2,4-diamine);methylboronic acid (PubChem CID 158110725) has the molecular formula C31H45BN8O4S2 and a molecular weight of 668.70 g/mol. Its IUPAC name is bis(5-(4-methoxy-5-methyl-2-propan-2-ylphenyl)sulfanylpyrimidine-2,4-diamine);methylboronic acid.
| Compound Name | bis(5-(4-methoxy-5-methyl-2-propan-2-ylphenyl)sulfanylpyrimidine-2,4-diamine);methylboronic acid |
|---|---|
| PubChem CID | 158110725 |
| Molecular Formula | C31H45BN8O4S2 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.31 |
| IUPAC Name | bis(5-(4-methoxy-5-methyl-2-propan-2-ylphenyl)sulfanylpyrimidine-2,4-diamine);methylboronic acid |
| SMILES | CB(O)O.COc1cc(C(C)C)c(Sc2cnc(N)nc2N)cc1C.COc1cc(C(C)C)c(Sc2cnc(N)nc2N)cc1C |
| InChI | InChI=1S/2C15H20N4OS.CH5BO2/c2*1-8(2)10-6-11(20-4)9(3)5-12(10)21-13-7-18-15(17)19-14(13)16;1-2(3)4/h2*5-8H,1-4H3,(H4,16,17,18,19);3-4H,1H3 |
| InChIKey | FQJZFXNOSFZUKD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 214.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|