C27H33BrN6O3S — CID 158113469
tert-butyl 4-[[2-[3-[2-amino-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-sulfanylidenepropyl]-5-bromo-4-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 158113469) has the molecular formula C27H33BrN6O3S and a molecular weight of 601.57 g/mol. Its IUPAC name is tert-butyl 4-[[2-[3-[2-amino-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-sulfanylidenepropyl]-5-bromo-4-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[3-[2-amino-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-sulfanylidenepropyl]-5-bromo-4-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 158113469 |
| Molecular Formula | C27H33BrN6O3S |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | tert-butyl 4-[[2-[3-[2-amino-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]-2-sulfanylidenepropyl]-5-bromo-4-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1noc(-c2ccc(CC(=S)Cc3cc(CN4CCN(C(=O)OC(C)(C)C)CC4)c(Br)cn3)c(N)c2)n1 |
| InChI | InChI=1S/C27H33BrN6O3S/c1-17-31-25(37-32-17)19-6-5-18(24(29)13-19)12-22(38)14-21-11-20(23(28)15-30-21)16-33-7-9-34(10-8-33)26(35)36-27(2,3)4/h5-6,11,13,15H,7-10,12,14,16,29H2,1-4H3 |
| InChIKey | FQSIWWBAISKRGV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|