About 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol
3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol (PubChem CID 158116279) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol.
Molecular Properties
| Compound Name | 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol |
| PubChem CID | 158116279 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol |
| SMILES | C#CC(C)(O)CC.C#CC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C10H10O.C6H10O/c1-3-10(2,11)9-7-5-4-6-8-9;1-4-6(3,7)5-2/h1,4-8,11H,2H3;1,7H,5H2,2-3H3 |
| InChIKey | FRASPBZWHRWJOJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol?
The IUPAC name of 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol (CID 158116279) is 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol.
What is the SMILES notation for 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol?
The canonical SMILES for 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol is C#CC(C)(O)CC.C#CC(C)(O)c1ccccc1.
What is the InChIKey of 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol?
The InChIKey is FRASPBZWHRWJOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O.C6H10O/c1-3-10(2,11)9-7-5-4-6-8-9;1-4-6(3,7)5-2/h1,4-8,11H,2H3;1,7H,5H2,2-3H3.
What are the key properties of 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol?
3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol has a molecular weight of 244.33 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpent-1-yn-3-ol;2-phenylbut-3-yn-2-ol is sourced from PubChem (CID 158116279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).