C24H21Cl4FN2 — CID 158120640
2-(1,1-dichloroprop-1-en-2-yl)aniline;2-(1,1-dichloroprop-1-en-2-yl)-N-(4-fluorophenyl)aniline (PubChem CID 158120640) has the molecular formula C24H21Cl4FN2 and a molecular weight of 498.26 g/mol. Its IUPAC name is 2-(1,1-dichloroprop-1-en-2-yl)aniline;2-(1,1-dichloroprop-1-en-2-yl)-N-(4-fluorophenyl)aniline.
| Compound Name | 2-(1,1-dichloroprop-1-en-2-yl)aniline;2-(1,1-dichloroprop-1-en-2-yl)-N-(4-fluorophenyl)aniline |
|---|---|
| PubChem CID | 158120640 |
| Molecular Formula | C24H21Cl4FN2 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 2-(1,1-dichloroprop-1-en-2-yl)aniline;2-(1,1-dichloroprop-1-en-2-yl)-N-(4-fluorophenyl)aniline |
| SMILES | CC(=C(Cl)Cl)c1ccccc1N.CC(=C(Cl)Cl)c1ccccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H12Cl2FN.C9H9Cl2N/c1-10(15(16)17)13-4-2-3-5-14(13)19-12-8-6-11(18)7-9-12;1-6(9(10)11)7-4-2-3-5-8(7)12/h2-9,19H,1H3;2-5H,12H2,1H3 |
| InChIKey | FROHURYTBGHIFB-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|