C10H10FN3 — CID 174888018
3-N-(4-fluorophenyl)-1H-pyrrole-3,4-diamine (PubChem CID 174888018) has the molecular formula C10H10FN3 and a molecular weight of 191.21 g/mol. Its IUPAC name is 3-N-(4-fluorophenyl)-1H-pyrrole-3,4-diamine.
| Compound Name | 3-N-(4-fluorophenyl)-1H-pyrrole-3,4-diamine |
|---|---|
| PubChem CID | 174888018 |
| Molecular Formula | C10H10FN3 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-N-(4-fluorophenyl)-1H-pyrrole-3,4-diamine |
| SMILES | Nc1c[nH]cc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FN3/c11-7-1-3-8(4-2-7)14-10-6-13-5-9(10)12/h1-6,13-14H,12H2 |
| InChIKey | VLMUCCFSOSIJLH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |