C28H34ClN2O7S+ — CID 158125511
benzenesulfonic acid;2-[[4-(2-chlorophenyl)-3-methoxycarbonyl-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]methoxy]ethylazanium (PubChem CID 158125511) has the molecular formula C28H34ClN2O7S+ and a molecular weight of 578.11 g/mol. Its IUPAC name is benzenesulfonic acid;2-[[4-(2-chlorophenyl)-3-methoxycarbonyl-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]methoxy]ethylazanium.
| Compound Name | benzenesulfonic acid;2-[[4-(2-chlorophenyl)-3-methoxycarbonyl-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]methoxy]ethylazanium |
|---|---|
| PubChem CID | 158125511 |
| Molecular Formula | C28H34ClN2O7S+ |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | benzenesulfonic acid;2-[[4-(2-chlorophenyl)-3-methoxycarbonyl-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinolin-2-yl]methoxy]ethylazanium |
| SMILES | COC(=O)C1=C(COCC[NH3+])NC2=C(C(=O)CC(C)(C)C2)C1c1ccccc1Cl.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C22H27ClN2O4.C6H6O3S/c1-22(2)10-15-19(17(26)11-22)18(13-6-4-5-7-14(13)23)20(21(27)28-3)16(25-15)12-29-9-8-24;7-10(8,9)6-4-2-1-3-5-6/h4-7,18,25H,8-12,24H2,1-3H3;1-5H,(H,7,8,9)/p+1 |
| InChIKey | FSCUMHIIOYGAMF-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|