C22H23F3N6S — CID 158126535
4-(3-hexylthiophen-2-yl)-2-(5-methyl-1H-pyrazol-3-yl)-6-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyridine (PubChem CID 158126535) has the molecular formula C22H23F3N6S and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-(3-hexylthiophen-2-yl)-2-(5-methyl-1H-pyrazol-3-yl)-6-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-(3-hexylthiophen-2-yl)-2-(5-methyl-1H-pyrazol-3-yl)-6-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 158126535 |
| Molecular Formula | C22H23F3N6S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 4-(3-hexylthiophen-2-yl)-2-(5-methyl-1H-pyrazol-3-yl)-6-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyridine |
| SMILES | CCCCCCc1ccsc1-c1cc(-c2cc(C)[nH]n2)nc(-c2n[nH]c(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C22H23F3N6S/c1-3-4-5-6-7-14-8-9-32-19(14)15-11-16(17-10-13(2)28-29-17)26-18(12-15)20-27-21(31-30-20)22(23,24)25/h8-12H,3-7H2,1-2H3,(H,28,29)(H,27,30,31) |
| InChIKey | YVBBGFBRGPGTQY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|