About 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine
4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 71217085) has the molecular formula C25H28N4S
and a molecular weight of 416.59 g/mol. Its IUPAC name is 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 71217085 |
| Molecular Formula | C25H28N4S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | CCCCCCc1ccc(-c2cc(-c3ccc(C)cc3)nc(-c3n[nH]c(C)n3)c2)s1 |
| InChI | InChI=1S/C25H28N4S/c1-4-5-6-7-8-21-13-14-24(30-21)20-15-22(19-11-9-17(2)10-12-19)27-23(16-20)25-26-18(3)28-29-25/h9-16H,4-8H2,1-3H3,(H,26,28,29) |
| InChIKey | RCVQTZMORBNOBH-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (CID 71217085) is 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine is CCCCCCc1ccc(-c2cc(-c3ccc(C)cc3)nc(-c3n[nH]c(C)n3)c2)s1.
What is the InChIKey of 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The InChIKey is RCVQTZMORBNOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N4S/c1-4-5-6-7-8-21-13-14-24(30-21)20-15-22(19-11-9-17(2)10-12-19)27-23(16-20)25-26-18(3)28-29-25/h9-16H,4-8H2,1-3H3,(H,26,28,29).
What are the key properties of 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine has a molecular weight of 416.59 g/mol, XLogP of 7.00, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-hexylthiophen-2-yl)-2-(4-methylphenyl)-6-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 71217085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).