C19H32O2Si — CID 15812690
(1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 15812690) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 15812690 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (1R)-1-[(3Z,3aS,4S,7aS)-3-ethylidene-3a,5,5-trimethyl-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | C/C=C1\CO[C@H]2CCC(C)(C)[C@H]([C@@H](O)C#C[Si](C)(C)C)[C@@]12C |
| InChI | InChI=1S/C19H32O2Si/c1-8-14-13-21-16-9-11-18(2,3)17(19(14,16)4)15(20)10-12-22(5,6)7/h8,15-17,20H,9,11,13H2,1-7H3/b14-8+/t15-,16-,17-,19-/m0/s1 |
| InChIKey | LKCTURUQNGPWCX-MBGOMGDLSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|