C83H127InN12O21S+ — CID 158128835
CID 158128835 (PubChem CID 158128835) has the molecular formula C83H127InN12O21S+ and a molecular weight of 1775.88 g/mol.
| Compound Name | CID 158128835 |
|---|---|
| PubChem CID | 158128835 |
| Molecular Formula | C83H127InN12O21S+ |
| Molecular Weight | 1775.88 g/mol |
| Exact Mass | 1774.80 |
| IUPAC Name | — |
| SMILES | C=c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C=2c1ccc(S(=O)(=O)NCCCCCC(=O)NC(CCCCNC(=O)CN2CCN(CC(=O)OC)CCN3CCN(CC2)CC(=O)O[In]OC(=O)C3)C(=O)CCCCCC(CC(=O)CCCCCCC(=O)NCCCCCNC(=O)N[C@H](C)CCC(=O)O)C(=O)O)cc1C.C[NH3+].O=C=O |
| InChI | InChI=1S/C81H123N11O19S.CH5N.CO2.In/c1-7-92(8-2)62-32-35-67-71(53-62)111-70-50-58(3)30-34-66(70)79(67)65-36-33-64(51-59(65)4)112(108,109)85-41-22-12-18-29-73(96)87-68(26-19-23-39-83-74(97)54-88-42-44-89(55-76(100)101)45-46-90(56-77(102)103)47-49-91(48-43-88)57-78(104)110-6)69(94)27-16-11-14-24-61(80(105)106)52-63(93)25-15-9-10-17-28-72(95)82-38-20-13-21-40-84-81(107)86-60(5)31-37-75(98)99;1-2;2-1-3;/h30,32-36,50-51,53,60-61,68,85H,3,7-29,31,37-49,52,54-57H2,1-2,4-6H3,(H,82,95)(H,83,97)(H,87,96)(H,98,99)(H,100,101)(H,102,103)(H,105,106)(H2,84,86,107);2H2,1H3;;/q;;;+2/p-1/t60-,61?,68?;;;/m1.../s1 |
| InChIKey | FSNBIXHKDNJISN-LVLMEFBBSA-M |
| XLogP | 3.88 |
| TPSA | 449.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 118 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1775.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|