C9H16N2O3S — CID 15813286
tert-butyl N-[(3S)-1-methoxy-2-sulfanylideneazetidin-3-yl]carbamate (PubChem CID 15813286) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-methoxy-2-sulfanylideneazetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-methoxy-2-sulfanylideneazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 15813286 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | tert-butyl N-[(3S)-1-methoxy-2-sulfanylideneazetidin-3-yl]carbamate |
| SMILES | CON1C[C@H](NC(=O)OC(C)(C)C)C1=S |
| InChI | InChI=1S/C9H16N2O3S/c1-9(2,3)14-8(12)10-6-5-11(13-4)7(6)15/h6H,5H2,1-4H3,(H,10,12)/t6-/m0/s1 |
| InChIKey | IKZWQQPBUMPXDJ-LURJTMIESA-N |
| XLogP | 1.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|