C34H60N2 — CID 158136489
N-methyl-N'-(3-methylphenyl)-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine (PubChem CID 158136489) has the molecular formula C34H60N2 and a molecular weight of 496.87 g/mol. Its IUPAC name is N-methyl-N'-(3-methylphenyl)-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine.
| Compound Name | N-methyl-N'-(3-methylphenyl)-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 158136489 |
| Molecular Formula | C34H60N2 |
| Molecular Weight | 496.87 g/mol |
| Exact Mass | 496.48 |
| IUPAC Name | N-methyl-N'-(3-methylphenyl)-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine |
| SMILES | Cc1cccc(N(CCCCCCN(C)C2CC(C)(C)CC(C)(C)C2)C2CC(C)(C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C34H60N2/c1-27-16-15-17-28(20-27)36(30-23-33(6,7)26-34(8,9)24-30)19-14-12-11-13-18-35(10)29-21-31(2,3)25-32(4,5)22-29/h15-17,20,29-30H,11-14,18-19,21-26H2,1-10H3 |
| InChIKey | FTKHKYZLTZBUKF-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.87 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|