C27H54N2 — CID 158648176
N'-methyl-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine (PubChem CID 158648176) has the molecular formula C27H54N2 and a molecular weight of 406.74 g/mol. Its IUPAC name is N'-methyl-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine.
| Compound Name | N'-methyl-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 158648176 |
| Molecular Formula | C27H54N2 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.43 |
| IUPAC Name | N'-methyl-N,N'-bis(3,3,5,5-tetramethylcyclohexyl)hexane-1,6-diamine |
| SMILES | CN(CCCCCCNC1CC(C)(C)CC(C)(C)C1)C1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C27H54N2/c1-24(2)16-22(17-25(3,4)20-24)28-14-12-10-11-13-15-29(9)23-18-26(5,6)21-27(7,8)19-23/h22-23,28H,10-21H2,1-9H3 |
| InChIKey | GGFRNBPPTSSKLQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|