C13H7ClN4S — CID 15814132
7-(5-chlorothiophen-2-yl)-1H-pyrazolo[4,3-g]quinoxaline (PubChem CID 15814132) has the molecular formula C13H7ClN4S and a molecular weight of 286.75 g/mol. Its IUPAC name is 7-(5-chlorothiophen-2-yl)-1H-pyrazolo[4,3-g]quinoxaline.
| Compound Name | 7-(5-chlorothiophen-2-yl)-1H-pyrazolo[4,3-g]quinoxaline |
|---|---|
| PubChem CID | 15814132 |
| Molecular Formula | C13H7ClN4S |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 7-(5-chlorothiophen-2-yl)-1H-pyrazolo[4,3-g]quinoxaline |
| SMILES | Clc1ccc(-c2cnc3cc4cn[nH]c4cc3n2)s1 |
| InChI | InChI=1S/C13H7ClN4S/c14-13-2-1-12(19-13)11-6-15-9-3-7-5-16-18-8(7)4-10(9)17-11/h1-6H,(H,16,18) |
| InChIKey | FPRPUQDODXIVJF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |