C59H90INO2Si2 — CID 158148600
(Z)-12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine;tert-butyl-[(Z)-12-iodododec-7-enoxy]-diphenylsilane (PubChem CID 158148600) has the molecular formula C59H90INO2Si2 and a molecular weight of 1028.45 g/mol. Its IUPAC name is (Z)-12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine;tert-butyl-[(Z)-12-iodododec-7-enoxy]-diphenylsilane.
| Compound Name | (Z)-12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine;tert-butyl-[(Z)-12-iodododec-7-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 158148600 |
| Molecular Formula | C59H90INO2Si2 |
| Molecular Weight | 1028.45 g/mol |
| Exact Mass | 1027.56 |
| IUPAC Name | (Z)-12-[tert-butyl(diphenyl)silyl]oxy-N-propan-2-yldodec-5-en-1-amine;tert-butyl-[(Z)-12-iodododec-7-enoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCCC/C=C\CCCCI)(c1ccccc1)c1ccccc1.CC(C)NCCCC/C=C\CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H49NOSi.C28H41IOSi/c1-28(2)32-26-20-12-10-8-6-7-9-11-13-21-27-33-34(31(3,4)5,29-22-16-14-17-23-29)30-24-18-15-19-25-30;1-28(2,3)31(26-20-14-12-15-21-26,27-22-16-13-17-23-27)30-25-19-11-9-7-5-4-6-8-10-18-24-29/h6,8,14-19,22-25,28,32H,7,9-13,20-21,26-27H2,1-5H3;4,6,12-17,20-23H,5,7-11,18-19,24-25H2,1-3H3/b8-6-;6-4- |
| InChIKey | FUUZAGAUDDRKPI-BUMCBBFJSA-N |
| XLogP | 14.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.45 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|