C58H88N4O2Si2 — CID 158073685
[(Z)-13-azidotridec-8-enoxy]-tert-butyl-diphenylsilane;(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine (PubChem CID 158073685) has the molecular formula C58H88N4O2Si2 and a molecular weight of 929.54 g/mol. Its IUPAC name is [(Z)-13-azidotridec-8-enoxy]-tert-butyl-diphenylsilane;(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine.
| Compound Name | [(Z)-13-azidotridec-8-enoxy]-tert-butyl-diphenylsilane;(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine |
|---|---|
| PubChem CID | 158073685 |
| Molecular Formula | C58H88N4O2Si2 |
| Molecular Weight | 929.54 g/mol |
| Exact Mass | 928.64 |
| IUPAC Name | [(Z)-13-azidotridec-8-enoxy]-tert-butyl-diphenylsilane;(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine |
| SMILES | CC(C)(C)[Si](OCCCCCCC/C=C\CCCCN)(c1ccccc1)c1ccccc1.CC(C)(C)[Si](OCCCCCCC/C=C\CCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H43N3OSi.C29H45NOSi/c1-29(2,3)34(27-21-15-13-16-22-27,28-23-17-14-18-24-28)33-26-20-12-10-8-6-4-5-7-9-11-19-25-31-32-30;1-29(2,3)32(27-21-15-13-16-22-27,28-23-17-14-18-24-28)31-26-20-12-10-8-6-4-5-7-9-11-19-25-30/h5,7,13-18,21-24H,4,6,8-12,19-20,25-26H2,1-3H3;5,7,13-18,21-24H,4,6,8-12,19-20,25-26,30H2,1-3H3/b2*7-5- |
| InChIKey | FMCQESQBFNVWFS-MGPXVROHSA-N |
| XLogP | 14.53 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.54 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|