C54H79N3O3Si2 — CID 158270375
[(Z)-11-azidoundec-6-enoxy]-tert-butyl-diphenylsilane;(Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol (PubChem CID 158270375) has the molecular formula C54H79N3O3Si2 and a molecular weight of 874.42 g/mol. Its IUPAC name is [(Z)-11-azidoundec-6-enoxy]-tert-butyl-diphenylsilane;(Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol.
| Compound Name | [(Z)-11-azidoundec-6-enoxy]-tert-butyl-diphenylsilane;(Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol |
|---|---|
| PubChem CID | 158270375 |
| Molecular Formula | C54H79N3O3Si2 |
| Molecular Weight | 874.42 g/mol |
| Exact Mass | 873.57 |
| IUPAC Name | [(Z)-11-azidoundec-6-enoxy]-tert-butyl-diphenylsilane;(Z)-11-[tert-butyl(diphenyl)silyl]oxyundec-5-en-1-ol |
| SMILES | CC(C)(C)[Si](OCCCCC/C=C\CCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1.CC(C)(C)[Si](OCCCCC/C=C\CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H39N3OSi.C27H40O2Si/c1-27(2,3)32(25-19-13-11-14-20-25,26-21-15-12-16-22-26)31-24-18-10-8-6-4-5-7-9-17-23-29-30-28;1-27(2,3)30(25-19-13-11-14-20-25,26-21-15-12-16-22-26)29-24-18-10-8-6-4-5-7-9-17-23-28/h4-5,11-16,19-22H,6-10,17-18,23-24H2,1-3H3;4-5,11-16,19-22,28H,6-10,17-18,23-24H2,1-3H3/b2*5-4- |
| InChIKey | GIYLHXBGGBYIOS-KERYXKJGSA-N |
| XLogP | 13.00 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.42 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|