C55H78O3Si2 — CID 158951184
11-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol;tert-butyl-dodec-6-ynoxy-diphenylsilane (PubChem CID 158951184) has the molecular formula C55H78O3Si2 and a molecular weight of 843.40 g/mol. Its IUPAC name is 11-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol;tert-butyl-dodec-6-ynoxy-diphenylsilane.
| Compound Name | 11-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol;tert-butyl-dodec-6-ynoxy-diphenylsilane |
|---|---|
| PubChem CID | 158951184 |
| Molecular Formula | C55H78O3Si2 |
| Molecular Weight | 843.40 g/mol |
| Exact Mass | 842.55 |
| IUPAC Name | 11-[tert-butyl(diphenyl)silyl]oxyundec-5-yn-1-ol;tert-butyl-dodec-6-ynoxy-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCCC#CCCCCO)(c1ccccc1)c1ccccc1.CCCCCC#CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40OSi.C27H38O2Si/c1-5-6-7-8-9-10-11-12-13-20-25-29-30(28(2,3)4,26-21-16-14-17-22-26)27-23-18-15-19-24-27;1-27(2,3)30(25-19-13-11-14-20-25,26-21-15-12-16-22-26)29-24-18-10-8-6-4-5-7-9-17-23-28/h14-19,21-24H,5-8,11-13,20,25H2,1-4H3;11-16,19-22,28H,6-10,17-18,23-24H2,1-3H3 |
| InChIKey | JLLGYRQTRMCUJQ-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.40 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|