C52H75N3O3Si2 — CID 159894033
[(Z)-10-azidodec-5-enoxy]-tert-butyl-diphenylsilane;(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-en-1-ol (PubChem CID 159894033) has the molecular formula C52H75N3O3Si2 and a molecular weight of 846.36 g/mol. Its IUPAC name is [(Z)-10-azidodec-5-enoxy]-tert-butyl-diphenylsilane;(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-en-1-ol.
| Compound Name | [(Z)-10-azidodec-5-enoxy]-tert-butyl-diphenylsilane;(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-en-1-ol |
|---|---|
| PubChem CID | 159894033 |
| Molecular Formula | C52H75N3O3Si2 |
| Molecular Weight | 846.36 g/mol |
| Exact Mass | 845.53 |
| IUPAC Name | [(Z)-10-azidodec-5-enoxy]-tert-butyl-diphenylsilane;(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-en-1-ol |
| SMILES | CC(C)(C)[Si](OCCCC/C=C\CCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1.CC(C)(C)[Si](OCCCC/C=C\CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H37N3OSi.C26H38O2Si/c1-26(2,3)31(24-18-12-10-13-19-24,25-20-14-11-15-21-25)30-23-17-9-7-5-4-6-8-16-22-28-29-27;1-26(2,3)29(24-18-12-10-13-19-24,25-20-14-11-15-21-25)28-23-17-9-7-5-4-6-8-16-22-27/h4-5,10-15,18-21H,6-9,16-17,22-23H2,1-3H3;4-5,10-15,18-21,27H,6-9,16-17,22-23H2,1-3H3/b2*5-4- |
| InChIKey | NVCQLJZFMMGLGC-KERYXKJGSA-N |
| XLogP | 12.22 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.36 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|