C49H66O3Si2 — CID 159013919
8-[tert-butyl(diphenyl)silyl]oxyoct-5-yn-1-ol;tert-butyl-non-3-ynoxy-diphenylsilane (PubChem CID 159013919) has the molecular formula C49H66O3Si2 and a molecular weight of 759.24 g/mol. Its IUPAC name is 8-[tert-butyl(diphenyl)silyl]oxyoct-5-yn-1-ol;tert-butyl-non-3-ynoxy-diphenylsilane.
| Compound Name | 8-[tert-butyl(diphenyl)silyl]oxyoct-5-yn-1-ol;tert-butyl-non-3-ynoxy-diphenylsilane |
|---|---|
| PubChem CID | 159013919 |
| Molecular Formula | C49H66O3Si2 |
| Molecular Weight | 759.24 g/mol |
| Exact Mass | 758.46 |
| IUPAC Name | 8-[tert-butyl(diphenyl)silyl]oxyoct-5-yn-1-ol;tert-butyl-non-3-ynoxy-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCC#CCCCCO)(c1ccccc1)c1ccccc1.CCCCCC#CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34OSi.C24H32O2Si/c1-5-6-7-8-9-10-17-22-26-27(25(2,3)4,23-18-13-11-14-19-23)24-20-15-12-16-21-24;1-24(2,3)27(22-16-10-8-11-17-22,23-18-12-9-13-19-23)26-21-15-7-5-4-6-14-20-25/h11-16,18-21H,5-8,17,22H2,1-4H3;8-13,16-19,25H,4,6,14-15,20-21H2,1-3H3 |
| InChIKey | JSVPQFCMDUQZPW-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.24 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|