C26H37N3OSi — CID 123780813
10-azidodec-5-enoxy-tert-butyl-diphenylsilane (PubChem CID 123780813) has the molecular formula C26H37N3OSi and a molecular weight of 435.69 g/mol. Its IUPAC name is 10-azidodec-5-enoxy-tert-butyl-diphenylsilane.
| Compound Name | 10-azidodec-5-enoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 123780813 |
| Molecular Formula | C26H37N3OSi |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 10-azidodec-5-enoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCC=CCCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H37N3OSi/c1-26(2,3)31(24-18-12-10-13-19-24,25-20-14-11-15-21-25)30-23-17-9-7-5-4-6-8-16-22-28-29-27/h4-5,10-15,18-21H,6-9,16-17,22-23H2,1-3H3 |
| InChIKey | MBRIVCKOAAZXJE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|