C21H25F2N3OSi — CID 21044037
[3-(azidomethyl)-2,2-difluorocyclopropyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 21044037) has the molecular formula C21H25F2N3OSi and a molecular weight of 401.53 g/mol. Its IUPAC name is [3-(azidomethyl)-2,2-difluorocyclopropyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [3-(azidomethyl)-2,2-difluorocyclopropyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 21044037 |
| Molecular Formula | C21H25F2N3OSi |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [3-(azidomethyl)-2,2-difluorocyclopropyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC1C(CN=[N+]=[N-])C1(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25F2N3OSi/c1-20(2,3)28(16-10-6-4-7-11-16,17-12-8-5-9-13-17)27-15-19-18(14-25-26-24)21(19,22)23/h4-13,18-19H,14-15H2,1-3H3 |
| InChIKey | BTEDMUCFDZIOPR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|