C27H39N3OSi — CID 123300702
11-azidoundec-6-enoxy-tert-butyl-diphenylsilane (PubChem CID 123300702) has the molecular formula C27H39N3OSi and a molecular weight of 449.72 g/mol. Its IUPAC name is 11-azidoundec-6-enoxy-tert-butyl-diphenylsilane.
| Compound Name | 11-azidoundec-6-enoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 123300702 |
| Molecular Formula | C27H39N3OSi |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 11-azidoundec-6-enoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCCC=CCCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H39N3OSi/c1-27(2,3)32(25-19-13-11-14-20-25,26-21-15-12-16-22-26)31-24-18-10-8-6-4-5-7-9-17-23-29-30-28/h4-5,11-16,19-22H,6-10,17-18,23-24H2,1-3H3 |
| InChIKey | NTXXPWGSLSNDBN-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|