C48H67N3O3Si2 — CID 158465466
[(Z)-8-azidooct-3-enoxy]-tert-butyl-diphenylsilane;(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-en-1-ol (PubChem CID 158465466) has the molecular formula C48H67N3O3Si2 and a molecular weight of 790.25 g/mol. Its IUPAC name is [(Z)-8-azidooct-3-enoxy]-tert-butyl-diphenylsilane;(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-en-1-ol.
| Compound Name | [(Z)-8-azidooct-3-enoxy]-tert-butyl-diphenylsilane;(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-en-1-ol |
|---|---|
| PubChem CID | 158465466 |
| Molecular Formula | C48H67N3O3Si2 |
| Molecular Weight | 790.25 g/mol |
| Exact Mass | 789.47 |
| IUPAC Name | [(Z)-8-azidooct-3-enoxy]-tert-butyl-diphenylsilane;(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-en-1-ol |
| SMILES | CC(C)(C)[Si](OCC/C=C\CCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1.CC(C)(C)[Si](OCC/C=C\CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33N3OSi.C24H34O2Si/c1-24(2,3)29(22-16-10-8-11-17-22,23-18-12-9-13-19-23)28-21-15-7-5-4-6-14-20-26-27-25;1-24(2,3)27(22-16-10-8-11-17-22,23-18-12-9-13-19-23)26-21-15-7-5-4-6-14-20-25/h5,7-13,16-19H,4,6,14-15,20-21H2,1-3H3;5,7-13,16-19,25H,4,6,14-15,20-21H2,1-3H3/b2*7-5- |
| InChIKey | HFRTZTVNRYELFR-MGPXVROHSA-N |
| XLogP | 10.66 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.25 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|