C56H83N3O3Si2 — CID 161163312
[(Z)-12-azidododec-7-enoxy]-tert-butyl-diphenylsilane;(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-ol (PubChem CID 161163312) has the molecular formula C56H83N3O3Si2 and a molecular weight of 902.47 g/mol. Its IUPAC name is [(Z)-12-azidododec-7-enoxy]-tert-butyl-diphenylsilane;(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-ol.
| Compound Name | [(Z)-12-azidododec-7-enoxy]-tert-butyl-diphenylsilane;(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-ol |
|---|---|
| PubChem CID | 161163312 |
| Molecular Formula | C56H83N3O3Si2 |
| Molecular Weight | 902.47 g/mol |
| Exact Mass | 901.60 |
| IUPAC Name | [(Z)-12-azidododec-7-enoxy]-tert-butyl-diphenylsilane;(Z)-12-[tert-butyl(diphenyl)silyl]oxydodec-5-en-1-ol |
| SMILES | CC(C)(C)[Si](OCCCCCC/C=C\CCCCN=[N+]=[N-])(c1ccccc1)c1ccccc1.CC(C)(C)[Si](OCCCCCC/C=C\CCCCO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H41N3OSi.C28H42O2Si/c1-28(2,3)33(26-20-14-12-15-21-26,27-22-16-13-17-23-27)32-25-19-11-9-7-5-4-6-8-10-18-24-30-31-29;1-28(2,3)31(26-20-14-12-15-21-26,27-22-16-13-17-23-27)30-25-19-11-9-7-5-4-6-8-10-18-24-29/h4,6,12-17,20-23H,5,7-11,18-19,24-25H2,1-3H3;4,6,12-17,20-23,29H,5,7-11,18-19,24-25H2,1-3H3/b2*6-4- |
| InChIKey | UQEYXNVGSFCQSB-WENNBGMGSA-N |
| XLogP | 13.78 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.47 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|