C57H82O3Si2 — CID 159544891
12-[tert-butyl(diphenyl)silyl]oxydodec-5-yn-1-ol;tert-butyl-diphenyl-tridec-7-ynoxysilane (PubChem CID 159544891) has the molecular formula C57H82O3Si2 and a molecular weight of 871.45 g/mol. Its IUPAC name is 12-[tert-butyl(diphenyl)silyl]oxydodec-5-yn-1-ol;tert-butyl-diphenyl-tridec-7-ynoxysilane.
| Compound Name | 12-[tert-butyl(diphenyl)silyl]oxydodec-5-yn-1-ol;tert-butyl-diphenyl-tridec-7-ynoxysilane |
|---|---|
| PubChem CID | 159544891 |
| Molecular Formula | C57H82O3Si2 |
| Molecular Weight | 871.45 g/mol |
| Exact Mass | 870.58 |
| IUPAC Name | 12-[tert-butyl(diphenyl)silyl]oxydodec-5-yn-1-ol;tert-butyl-diphenyl-tridec-7-ynoxysilane |
| SMILES | CC(C)(C)[Si](OCCCCCCC#CCCCCO)(c1ccccc1)c1ccccc1.CCCCCC#CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H42OSi.C28H40O2Si/c1-5-6-7-8-9-10-11-12-13-14-21-26-30-31(29(2,3)4,27-22-17-15-18-23-27)28-24-19-16-20-25-28;1-28(2,3)31(26-20-14-12-15-21-26,27-22-16-13-17-23-27)30-25-19-11-9-7-5-4-6-8-10-18-24-29/h15-20,22-25H,5-8,11-14,21,26H2,1-4H3;12-17,20-23,29H,5,7-11,18-19,24-25H2,1-3H3 |
| InChIKey | MERDQKGFFXAMHM-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.45 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|