C64H101N3O3Si2 — CID 159372915
(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine;1-[(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-enyl]-3-pentylurea (PubChem CID 159372915) has the molecular formula C64H101N3O3Si2 and a molecular weight of 1016.70 g/mol. Its IUPAC name is (Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine;1-[(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-enyl]-3-pentylurea.
| Compound Name | (Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine;1-[(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 159372915 |
| Molecular Formula | C64H101N3O3Si2 |
| Molecular Weight | 1016.70 g/mol |
| Exact Mass | 1015.74 |
| IUPAC Name | (Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-en-1-amine;1-[(Z)-13-[tert-butyl(diphenyl)silyl]oxytridec-5-enyl]-3-pentylurea |
| SMILES | CC(C)(C)[Si](OCCCCCCC/C=C\CCCCN)(c1ccccc1)c1ccccc1.CCCCCNC(=O)NCCCC/C=C\CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H56N2O2Si.C29H45NOSi/c1-5-6-22-29-36-34(38)37-30-23-14-12-10-8-7-9-11-13-15-24-31-39-40(35(2,3)4,32-25-18-16-19-26-32)33-27-20-17-21-28-33;1-29(2,3)32(27-21-15-13-16-22-27,28-23-17-14-18-24-28)31-26-20-12-10-8-6-4-5-7-9-11-19-25-30/h8,10,16-21,25-28H,5-7,9,11-15,22-24,29-31H2,1-4H3,(H2,36,37,38);5,7,13-18,21-24H,4,6,8-12,19-20,25-26,30H2,1-3H3/b10-8-;7-5- |
| InChIKey | LJYQFHGKSLTUFX-PHOPSGCESA-N |
| XLogP | 14.71 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.70 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|