C17H17F3N2O2S — CID 158152152
[3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-piperidin-1-ylmethanone (PubChem CID 158152152) has the molecular formula C17H17F3N2O2S and a molecular weight of 370.40 g/mol. Its IUPAC name is [3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 158152152 |
| Molecular Formula | C17H17F3N2O2S |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1=C(O)CS/C1=N\c1ccccc1C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C17H17F3N2O2S/c18-17(19,20)11-6-2-3-7-12(11)21-15-14(13(23)10-25-15)16(24)22-8-4-1-5-9-22/h2-3,6-7,23H,1,4-5,8-10H2/b21-15- |
| InChIKey | GPQOPOXYOGJQQI-QNGOZBTKSA-N |
| XLogP | 4.31 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|