C16H15F3N2O2S — CID 162198807
[3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 162198807) has the molecular formula C16H15F3N2O2S and a molecular weight of 356.37 g/mol. Its IUPAC name is [3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 162198807 |
| Molecular Formula | C16H15F3N2O2S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | [3-hydroxy-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophen-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1=C(O)CS/C1=N\c1ccccc1C(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C16H15F3N2O2S/c17-16(18,19)10-5-1-2-6-11(10)20-14-13(12(22)9-24-14)15(23)21-7-3-4-8-21/h1-2,5-6,22H,3-4,7-9H2/b20-14- |
| InChIKey | PKMLZTFOCZYCGW-ZHZULCJRSA-N |
| XLogP | 3.92 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|