C19H21F3N2O2S — CID 160924154
N-cyclohexyl-3-hydroxy-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide (PubChem CID 160924154) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is N-cyclohexyl-3-hydroxy-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide.
| Compound Name | N-cyclohexyl-3-hydroxy-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide |
|---|---|
| PubChem CID | 160924154 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-cyclohexyl-3-hydroxy-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide |
| SMILES | CN(C(=O)C1=C(O)CS/C1=N\c1ccccc1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C19H21F3N2O2S/c1-24(12-7-3-2-4-8-12)18(26)16-15(25)11-27-17(16)23-14-10-6-5-9-13(14)19(20,21)22/h5-6,9-10,12,25H,2-4,7-8,11H2,1H3/b23-17- |
| InChIKey | WVUFCAQZYGVSQB-QJOMJCCJSA-N |
| XLogP | 5.09 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|