C16H17F3N2O3S — CID 159190105
3-hydroxy-N-(2-methoxyethyl)-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide (PubChem CID 159190105) has the molecular formula C16H17F3N2O3S and a molecular weight of 374.38 g/mol. Its IUPAC name is 3-hydroxy-N-(2-methoxyethyl)-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide.
| Compound Name | 3-hydroxy-N-(2-methoxyethyl)-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide |
|---|---|
| PubChem CID | 159190105 |
| Molecular Formula | C16H17F3N2O3S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-hydroxy-N-(2-methoxyethyl)-N-methyl-5-[2-(trifluoromethyl)phenyl]imino-2H-thiophene-4-carboxamide |
| SMILES | COCCN(C)C(=O)C1=C(O)CS/C1=N\c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O3S/c1-21(7-8-24-2)15(23)13-12(22)9-25-14(13)20-11-6-4-3-5-10(11)16(17,18)19/h3-6,22H,7-9H2,1-2H3/b20-14- |
| InChIKey | QDZNPDNAGPTXAR-ZHZULCJRSA-N |
| XLogP | 3.40 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|