About ethane;indolizine;indolizine-1-carbaldehyde
ethane;indolizine;indolizine-1-carbaldehyde (PubChem CID 158153526) has the molecular formula C25H38N2O
and a molecular weight of 382.59 g/mol. Its IUPAC name is ethane;indolizine;indolizine-1-carbaldehyde.
Molecular Properties
| Compound Name | ethane;indolizine;indolizine-1-carbaldehyde |
| PubChem CID | 158153526 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | ethane;indolizine;indolizine-1-carbaldehyde |
| SMILES | CC.CC.CC.CC.O=Cc1ccn2ccccc12.c1ccn2cccc2c1 |
| InChI | InChI=1S/C9H7NO.C8H7N.4C2H6/c11-7-8-4-6-10-5-2-1-3-9(8)10;1-2-6-9-7-3-5-8(9)4-1;4*1-2/h1-7H;1-7H;4*1-2H3 |
| InChIKey | FVKGUCDDAASLBU-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 25.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;indolizine;indolizine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;indolizine;indolizine-1-carbaldehyde?
The IUPAC name of ethane;indolizine;indolizine-1-carbaldehyde (CID 158153526) is ethane;indolizine;indolizine-1-carbaldehyde.
What is the SMILES notation for ethane;indolizine;indolizine-1-carbaldehyde?
The canonical SMILES for ethane;indolizine;indolizine-1-carbaldehyde is CC.CC.CC.CC.O=Cc1ccn2ccccc12.c1ccn2cccc2c1.
What is the InChIKey of ethane;indolizine;indolizine-1-carbaldehyde?
The InChIKey is FVKGUCDDAASLBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C8H7N.4C2H6/c11-7-8-4-6-10-5-2-1-3-9(8)10;1-2-6-9-7-3-5-8(9)4-1;4*1-2/h1-7H;1-7H;4*1-2H3.
What are the key properties of ethane;indolizine;indolizine-1-carbaldehyde?
ethane;indolizine;indolizine-1-carbaldehyde has a molecular weight of 382.59 g/mol, XLogP of 7.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;indolizine;indolizine-1-carbaldehyde is sourced from PubChem (CID 158153526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).