About 8-iodoindolizine
8-iodoindolizine (PubChem CID 134691902) has the molecular formula C8H6IN
and a molecular weight of 243.05 g/mol. Its IUPAC name is 8-iodoindolizine.
Molecular Properties
| Compound Name | 8-iodoindolizine |
| PubChem CID | 134691902 |
| Molecular Formula | C8H6IN |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 8-iodoindolizine |
| SMILES | Ic1cccn2cccc12 |
| InChI | InChI=1S/C8H6IN/c9-7-3-1-5-10-6-2-4-8(7)10/h1-6H |
| InChIKey | UPHPLDITAWMUDQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodoindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodoindolizine?
The IUPAC name of 8-iodoindolizine (CID 134691902) is 8-iodoindolizine.
What is the SMILES notation for 8-iodoindolizine?
The canonical SMILES for 8-iodoindolizine is Ic1cccn2cccc12.
What is the InChIKey of 8-iodoindolizine?
The InChIKey is UPHPLDITAWMUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6IN/c9-7-3-1-5-10-6-2-4-8(7)10/h1-6H.
What are the key properties of 8-iodoindolizine?
8-iodoindolizine has a molecular weight of 243.05 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodoindolizine is sourced from PubChem (CID 134691902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).