C10H18F2O5S — CID 158165871
1,1-difluoro-2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]pentane-1-sulfonic acid (PubChem CID 158165871) has the molecular formula C10H18F2O5S and a molecular weight of 288.31 g/mol. Its IUPAC name is 1,1-difluoro-2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]pentane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]pentane-1-sulfonic acid |
|---|---|
| PubChem CID | 158165871 |
| Molecular Formula | C10H18F2O5S |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1,1-difluoro-2-[(1-hydroxy-2-methylprop-2-enoxy)methyl]pentane-1-sulfonic acid |
| SMILES | C=C(C)C(O)OCC(CCC)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H18F2O5S/c1-4-5-8(6-17-9(13)7(2)3)10(11,12)18(14,15)16/h8-9,13H,2,4-6H2,1,3H3,(H,14,15,16) |
| InChIKey | FWVIQYPIPBJBDN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|