C13H10F4N2O2S — CID 158168157
2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2H-pyrazine-3,5-dione (PubChem CID 158168157) has the molecular formula C13H10F4N2O2S and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2H-pyrazine-3,5-dione.
| Compound Name | 2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2H-pyrazine-3,5-dione |
|---|---|
| PubChem CID | 158168157 |
| Molecular Formula | C13H10F4N2O2S |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2H-pyrazine-3,5-dione |
| SMILES | Cc1cc(F)c(C2N=CC(=O)NC2=O)cc1SCC(F)(F)F |
| InChI | InChI=1S/C13H10F4N2O2S/c1-6-2-8(14)7(3-9(6)22-5-13(15,16)17)11-12(21)19-10(20)4-18-11/h2-4,11H,5H2,1H3,(H,19,20,21) |
| InChIKey | FXCKRHNEHIKQLL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|