C20H17FN2O4 — CID 158184106
4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-2-oxopropyl]iminomethyl]-2-fluorobenzonitrile (PubChem CID 158184106) has the molecular formula C20H17FN2O4 and a molecular weight of 368.36 g/mol. Its IUPAC name is 4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-2-oxopropyl]iminomethyl]-2-fluorobenzonitrile.
| Compound Name | 4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-2-oxopropyl]iminomethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 158184106 |
| Molecular Formula | C20H17FN2O4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methoxy-2-oxopropyl]iminomethyl]-2-fluorobenzonitrile |
| SMILES | COC(C(=O)C/N=C/c1ccc(C#N)c(F)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H17FN2O4/c1-25-20(14-4-5-18-19(9-14)27-7-6-26-18)17(24)12-23-11-13-2-3-15(10-22)16(21)8-13/h2-5,8-9,11,20H,6-7,12H2,1H3/b23-11+ |
| InChIKey | FYYCIXDHCLZXHJ-FOKLQQMPSA-N |
| XLogP | 2.84 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|