C13H13F3O2 — CID 15819402
(4aR,5R)-5-ethynyl-5-hydroxy-4a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-naphthalen-2-one (PubChem CID 15819402) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is (4aR,5R)-5-ethynyl-5-hydroxy-4a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-naphthalen-2-one.
| Compound Name | (4aR,5R)-5-ethynyl-5-hydroxy-4a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 15819402 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (4aR,5R)-5-ethynyl-5-hydroxy-4a-(trifluoromethyl)-4,6,7,8-tetrahydro-3H-naphthalen-2-one |
| SMILES | C#C[C@]1(O)CCCC2=CC(=O)CC[C@@]21C(F)(F)F |
| InChI | InChI=1S/C13H13F3O2/c1-2-11(18)6-3-4-9-8-10(17)5-7-12(9,11)13(14,15)16/h1,8,18H,3-7H2/t11-,12+/m0/s1 |
| InChIKey | MDPMZXQWCOEESV-NWDGAFQWSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|