C24H24BBrF4N2O2 — CID 158212353
6-bromo-1-(difluoromethyl)indole;1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 158212353) has the molecular formula C24H24BBrF4N2O2 and a molecular weight of 539.18 g/mol. Its IUPAC name is 6-bromo-1-(difluoromethyl)indole;1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-bromo-1-(difluoromethyl)indole;1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 158212353 |
| Molecular Formula | C24H24BBrF4N2O2 |
| Molecular Weight | 539.18 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 6-bromo-1-(difluoromethyl)indole;1-(difluoromethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2ccc3ccn(C(F)F)c3c2)OC1(C)C.FC(F)n1ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H18BF2NO2.C9H6BrF2N/c1-14(2)15(3,4)21-16(20-14)11-6-5-10-7-8-19(13(17)18)12(10)9-11;10-7-2-1-6-3-4-13(9(11)12)8(6)5-7/h5-9,13H,1-4H3;1-5,9H |
| InChIKey | GCFQXMQRTAIIDV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.18 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|