C18H15BrN4O7 — CID 158216757
6-bromo-3-formamido-4-methyl-2-nitrobenzoic acid;7-methyl-3H-benzimidazole-4-carboxylic acid (PubChem CID 158216757) has the molecular formula C18H15BrN4O7 and a molecular weight of 479.24 g/mol. Its IUPAC name is 6-bromo-3-formamido-4-methyl-2-nitrobenzoic acid;7-methyl-3H-benzimidazole-4-carboxylic acid.
| Compound Name | 6-bromo-3-formamido-4-methyl-2-nitrobenzoic acid;7-methyl-3H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 158216757 |
| Molecular Formula | C18H15BrN4O7 |
| Molecular Weight | 479.24 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 6-bromo-3-formamido-4-methyl-2-nitrobenzoic acid;7-methyl-3H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(Br)c(C(=O)O)c([N+](=O)[O-])c1NC=O.Cc1ccc(C(=O)O)c2[nH]cnc12 |
| InChI | InChI=1S/C9H7BrN2O5.C9H8N2O2/c1-4-2-5(10)6(9(14)15)8(12(16)17)7(4)11-3-13;1-5-2-3-6(9(12)13)8-7(5)10-4-11-8/h2-3H,1H3,(H,11,13)(H,14,15);2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | GCTCHFIOIAYSGP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 175.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|