C15H12BrNO6 — CID 158417737
4-bromo-2-methylbenzene-1,3-dicarboxylic acid;nitrobenzene (PubChem CID 158417737) has the molecular formula C15H12BrNO6 and a molecular weight of 382.17 g/mol. Its IUPAC name is 4-bromo-2-methylbenzene-1,3-dicarboxylic acid;nitrobenzene.
| Compound Name | 4-bromo-2-methylbenzene-1,3-dicarboxylic acid;nitrobenzene |
|---|---|
| PubChem CID | 158417737 |
| Molecular Formula | C15H12BrNO6 |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 4-bromo-2-methylbenzene-1,3-dicarboxylic acid;nitrobenzene |
| SMILES | Cc1c(C(=O)O)ccc(Br)c1C(=O)O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C9H7BrO4.C6H5NO2/c1-4-5(8(11)12)2-3-6(10)7(4)9(13)14;8-7(9)6-4-2-1-3-5-6/h2-3H,1H3,(H,11,12)(H,13,14);1-5H |
| InChIKey | HACKUCQDPHNLJP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|