C20H23ClFN3O2 — CID 158217364
(3-chloro-4-fluorophenyl)-[4-(4-pyrimidin-4-yloxybutyl)piperidin-1-yl]methanone (PubChem CID 158217364) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[4-(4-pyrimidin-4-yloxybutyl)piperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[4-(4-pyrimidin-4-yloxybutyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 158217364 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[4-(4-pyrimidin-4-yloxybutyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)c(Cl)c1)N1CCC(CCCCOc2ccncn2)CC1 |
| InChI | InChI=1S/C20H23ClFN3O2/c21-17-13-16(4-5-18(17)22)20(26)25-10-7-15(8-11-25)3-1-2-12-27-19-6-9-23-14-24-19/h4-6,9,13-15H,1-3,7-8,10-12H2 |
| InChIKey | UHYSHDQNYNHZFP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|