C60H62BBrN2O2 — CID 158224253
2-[4-(4-bromophenyl)phenyl]pyridine;2-[4-[4-(4-tert-butylphenyl)phenyl]phenyl]pyridine;2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158224253) has the molecular formula C60H62BBrN2O2 and a molecular weight of 933.88 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)phenyl]pyridine;2-[4-[4-(4-tert-butylphenyl)phenyl]phenyl]pyridine;2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(4-bromophenyl)phenyl]pyridine;2-[4-[4-(4-tert-butylphenyl)phenyl]phenyl]pyridine;2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158224253 |
| Molecular Formula | C60H62BBrN2O2 |
| Molecular Weight | 933.88 g/mol |
| Exact Mass | 932.41 |
| IUPAC Name | 2-[4-(4-bromophenyl)phenyl]pyridine;2-[4-[4-(4-tert-butylphenyl)phenyl]phenyl]pyridine;2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Brc1ccc(-c2ccc(-c3ccccn3)cc2)cc1.CC(C)(C)c1ccc(-c2ccc(-c3ccc(-c4ccccn4)cc3)cc2)cc1.CC(C)(C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C27H25N.C17H12BrN.C16H25BO2/c1-27(2,3)25-17-15-23(16-18-25)21-9-7-20(8-10-21)22-11-13-24(14-12-22)26-6-4-5-19-28-26;18-16-10-8-14(9-11-16)13-4-6-15(7-5-13)17-3-1-2-12-19-17;1-14(2,3)12-8-10-13(11-9-12)17-18-15(4,5)16(6,7)19-17/h4-19H,1-3H3;1-12H;8-11H,1-7H3 |
| InChIKey | GDPLMCSZKABOBY-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.88 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|