C38H35BF4N2O2 — CID 165148819
2-(2,4-difluorophenyl)-5-[2-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyridine (PubChem CID 165148819) has the molecular formula C38H35BF4N2O2 and a molecular weight of 638.51 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-5-[2-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyridine.
| Compound Name | 2-(2,4-difluorophenyl)-5-[2-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyridine |
|---|---|
| PubChem CID | 165148819 |
| Molecular Formula | C38H35BF4N2O2 |
| Molecular Weight | 638.51 g/mol |
| Exact Mass | 638.27 |
| IUPAC Name | 2-(2,4-difluorophenyl)-5-[2-[3-[2-[6-(2,4-difluorophenyl)-3-pyridinyl]ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]pyridine |
| SMILES | CC1(C)OB(c2cc(CCc3ccc(-c4ccc(F)cc4F)nc3)cc(CCc3ccc(-c4ccc(F)cc4F)nc3)c2)OC1(C)C |
| InChI | InChI=1S/C38H35BF4N2O2/c1-37(2)38(3,4)47-39(46-37)28-18-26(7-5-24-9-15-35(44-22-24)31-13-11-29(40)20-33(31)42)17-27(19-28)8-6-25-10-16-36(45-23-25)32-14-12-30(41)21-34(32)43/h9-23H,5-8H2,1-4H3 |
| InChIKey | USMTUAQYQGZWPI-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.51 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|