C42H39BN2O6 — CID 165149204
9-methyl-3-[2-[3-[2-(9-methyl-5-oxochromeno[4,3-b]pyridin-3-yl)ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]chromeno[4,3-b]pyridin-5-one (PubChem CID 165149204) has the molecular formula C42H39BN2O6 and a molecular weight of 678.59 g/mol. Its IUPAC name is 9-methyl-3-[2-[3-[2-(9-methyl-5-oxochromeno[4,3-b]pyridin-3-yl)ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]chromeno[4,3-b]pyridin-5-one.
| Compound Name | 9-methyl-3-[2-[3-[2-(9-methyl-5-oxochromeno[4,3-b]pyridin-3-yl)ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]chromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 165149204 |
| Molecular Formula | C42H39BN2O6 |
| Molecular Weight | 678.59 g/mol |
| Exact Mass | 678.29 |
| IUPAC Name | 9-methyl-3-[2-[3-[2-(9-methyl-5-oxochromeno[4,3-b]pyridin-3-yl)ethyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]chromeno[4,3-b]pyridin-5-one |
| SMILES | Cc1ccc2oc(=O)c3cc(CCc4cc(CCc5cnc6c(c5)c(=O)oc5ccc(C)cc56)cc(B5OC(C)(C)C(C)(C)O5)c4)cnc3c2c1 |
| InChI | InChI=1S/C42H39BN2O6/c1-24-7-13-35-31(15-24)37-33(39(46)48-35)20-28(22-44-37)11-9-26-17-27(19-30(18-26)43-50-41(3,4)42(5,6)51-43)10-12-29-21-34-38(45-23-29)32-16-25(2)8-14-36(32)49-40(34)47/h7-8,13-23H,9-12H2,1-6H3 |
| InChIKey | NJIINGJECSBNSQ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|