C22H25BF2O4S — CID 167590447
2-[3-(cyclopropylsulfonylmethyl)-5-(2,4-difluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 167590447) has the molecular formula C22H25BF2O4S and a molecular weight of 434.31 g/mol. Its IUPAC name is 2-[3-(cyclopropylsulfonylmethyl)-5-(2,4-difluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(cyclopropylsulfonylmethyl)-5-(2,4-difluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 167590447 |
| Molecular Formula | C22H25BF2O4S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[3-(cyclopropylsulfonylmethyl)-5-(2,4-difluorophenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(CS(=O)(=O)C3CC3)cc(-c3ccc(F)cc3F)c2)OC1(C)C |
| InChI | InChI=1S/C22H25BF2O4S/c1-21(2)22(3,4)29-23(28-21)16-10-14(13-30(26,27)18-6-7-18)9-15(11-16)19-8-5-17(24)12-20(19)25/h5,8-12,18H,6-7,13H2,1-4H3 |
| InChIKey | SAIBFCKOPOIFJM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|