C24H28BBrCl2N4O2 — CID 158229275
5-bromo-4-chloro-2-ethylindazole;4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 158229275) has the molecular formula C24H28BBrCl2N4O2 and a molecular weight of 566.14 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-ethylindazole;4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 5-bromo-4-chloro-2-ethylindazole;4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 158229275 |
| Molecular Formula | C24H28BBrCl2N4O2 |
| Molecular Weight | 566.14 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 5-bromo-4-chloro-2-ethylindazole;4-chloro-2-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | CCn1cc2c(Cl)c(B3OC(C)(C)C(C)(C)O3)ccc2n1.CCn1cc2c(Cl)c(Br)ccc2n1 |
| InChI | InChI=1S/C15H20BClN2O2.C9H8BrClN2/c1-6-19-9-10-12(18-19)8-7-11(13(10)17)16-20-14(2,3)15(4,5)21-16;1-2-13-5-6-8(12-13)4-3-7(10)9(6)11/h7-9H,6H2,1-5H3;3-5H,2H2,1H3 |
| InChIKey | GEEHOQKKEHCHRZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.14 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|