C26H37BN2O3 — CID 158229584
3,3-dimethyl-1-[(1R,3S,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one (PubChem CID 158229584) has the molecular formula C26H37BN2O3 and a molecular weight of 436.41 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(1R,3S,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[(1R,3S,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one |
|---|---|
| PubChem CID | 158229584 |
| Molecular Formula | C26H37BN2O3 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 3,3-dimethyl-1-[(1R,3S,4S)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-indol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]butan-1-one |
| SMILES | CC(C)(C)CC(=O)N1[C@@H]2CC[C@@H](C2)[C@H]1C1=Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1 |
| InChI | InChI=1S/C26H37BN2O3/c1-24(2,3)15-22(30)29-19-10-8-16(13-19)23(29)21-14-17-12-18(9-11-20(17)28-21)27-31-25(4,5)26(6,7)32-27/h9,11-12,16,19,23H,8,10,13-15H2,1-7H3/t16-,19+,23-/m0/s1 |
| InChIKey | FAHTZCCOKXPIOG-QUZZAMIASA-N |
| XLogP | 4.43 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|