C15H27F3O — CID 158230326
1,1-difluoro-1-(3-fluoro-1,2,2,3,4,4-hexamethylcyclobutyl)-3-methylbutan-2-ol (PubChem CID 158230326) has the molecular formula C15H27F3O and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,1-difluoro-1-(3-fluoro-1,2,2,3,4,4-hexamethylcyclobutyl)-3-methylbutan-2-ol.
| Compound Name | 1,1-difluoro-1-(3-fluoro-1,2,2,3,4,4-hexamethylcyclobutyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 158230326 |
| Molecular Formula | C15H27F3O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1,1-difluoro-1-(3-fluoro-1,2,2,3,4,4-hexamethylcyclobutyl)-3-methylbutan-2-ol |
| SMILES | CC(C)C(O)C(F)(F)C1(C)C(C)(C)C(C)(F)C1(C)C |
| InChI | InChI=1S/C15H27F3O/c1-9(2)10(19)15(17,18)13(7)11(3,4)14(8,16)12(13,5)6/h9-10,19H,1-8H3 |
| InChIKey | USBNGWHOAQDGKC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |