C9H17F3O — CID 129270186
6,6,6-trifluoro-2,4,4-trimethylhexan-3-ol (PubChem CID 129270186) has the molecular formula C9H17F3O and a molecular weight of 198.23 g/mol. Its IUPAC name is 6,6,6-trifluoro-2,4,4-trimethylhexan-3-ol.
| Compound Name | 6,6,6-trifluoro-2,4,4-trimethylhexan-3-ol |
|---|---|
| PubChem CID | 129270186 |
| Molecular Formula | C9H17F3O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6,6,6-trifluoro-2,4,4-trimethylhexan-3-ol |
| SMILES | CC(C)C(O)C(C)(C)CC(F)(F)F |
| InChI | InChI=1S/C9H17F3O/c1-6(2)7(13)8(3,4)5-9(10,11)12/h6-7,13H,5H2,1-4H3 |
| InChIKey | ZJGJCVKIPUKDDM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |